Table of Contents
Details |
Physical and Chemical Properties |
Synonyms |
2D Structure |
3D Structure |
ADMET Properties |
Targets (proven and/or predicted) |
Plants that contains it |
Cross-Links |
Details
Top
Internal ID | ba2f30fc-b3d8-4438-b544-e8b2a367b699 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 5,7-dihydroxy-8-[2-hydroxy-5-(5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl]-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | COC1=CC(=C2C(=O)CC(OC2=C1)C3=CC(=C(C=C3)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=C2C(=O)CC(OC2=C1)C3=CC(=C(C=C3)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)O)O |
InChI | InChI=1S/C31H22O10/c1-39-17-9-20(34)29-23(37)12-26(40-27(29)10-17)15-4-7-19(33)18(8-15)28-21(35)11-22(36)30-24(38)13-25(41-31(28)30)14-2-5-16(32)6-3-14/h2-11,13,26,32-36H,12H2,1H3 |
InChI Key | XMFILYNCNQOLOA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Physical and Chemical Properties
Top
Molecular Formula | C31H22O10 |
Molecular Weight | 554.50 g/mol |
Exact Mass | 554.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | 5.10 |
Atomic LogP (AlogP) | 5.37 |
H-Bond Acceptor | 10 |
H-Bond Donor | 5 |
Rotatable Bonds | 4 |
Synonyms
Top
There are no found synonyms.
2D Structure
Top
3D Structure
Top
ADMET Properties (via admetSAR 2)
Top
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8865 | 88.65% |
Caco-2 | - | 0.8997 | 89.97% |
Blood Brain Barrier | - | 0.7500 | 75.00% |
Human oral bioavailability | - | 0.8857 | 88.57% |
Subcellular localzation | Mitochondria | 0.8141 | 81.41% |
OATP2B1 inhibitior | - | 0.5611 | 56.11% |
OATP1B1 inhibitior | + | 0.8328 | 83.28% |
OATP1B3 inhibitior | + | 0.9858 | 98.58% |
MATE1 inhibitior | - | 0.8000 | 80.00% |
OCT2 inhibitior | - | 0.9000 | 90.00% |
BSEP inhibitior | + | 0.8890 | 88.90% |
P-glycoprotein inhibitior | + | 0.8432 | 84.32% |
P-glycoprotein substrate | - | 0.5953 | 59.53% |
CYP3A4 substrate | + | 0.6615 | 66.15% |
CYP2C9 substrate | - | 0.5712 | 57.12% |
CYP2D6 substrate | - | 0.7945 | 79.45% |
CYP3A4 inhibition | + | 0.6809 | 68.09% |
CYP2C9 inhibition | + | 0.8394 | 83.94% |
CYP2C19 inhibition | + | 0.7445 | 74.45% |
CYP2D6 inhibition | - | 0.5420 | 54.20% |
CYP1A2 inhibition | + | 0.7317 | 73.17% |
CYP2C8 inhibition | + | 0.7709 | 77.09% |
CYP inhibitory promiscuity | + | 0.6165 | 61.65% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.9400 | 94.00% |
Carcinogenicity (trinary) | Non-required | 0.5433 | 54.33% |
Eye corrosion | - | 0.9896 | 98.96% |
Eye irritation | - | 0.8457 | 84.57% |
Skin irritation | - | 0.7211 | 72.11% |
Skin corrosion | - | 0.9237 | 92.37% |
Ames mutagenesis | + | 0.5600 | 56.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3674 | 36.74% |
Micronuclear | + | 0.8259 | 82.59% |
Hepatotoxicity | - | 0.7250 | 72.50% |
skin sensitisation | - | 0.9453 | 94.53% |
Respiratory toxicity | - | 0.5111 | 51.11% |
Reproductive toxicity | + | 0.8667 | 86.67% |
Mitochondrial toxicity | + | 0.7625 | 76.25% |
Nephrotoxicity | - | 0.5781 | 57.81% |
Acute Oral Toxicity (c) | III | 0.4326 | 43.26% |
Estrogen receptor binding | + | 0.8721 | 87.21% |
Androgen receptor binding | + | 0.8918 | 89.18% |
Thyroid receptor binding | + | 0.6061 | 60.61% |
Glucocorticoid receptor binding | + | 0.7619 | 76.19% |
Aromatase binding | - | 0.5147 | 51.47% |
PPAR gamma | + | 0.6729 | 67.29% |
Honey bee toxicity | - | 0.6708 | 67.08% |
Biodegradation | - | 0.9000 | 90.00% |
Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
Fish aquatic toxicity | + | 0.8016 | 80.16% |
Targets
Top
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.64% | 91.11% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 98.35% | 98.35% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 98.09% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 95.85% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.54% | 94.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 95.36% | 96.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.96% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.54% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.17% | 95.56% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 91.60% | 88.48% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.50% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.80% | 85.14% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 90.65% | 85.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.36% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.31% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 88.75% | 90.71% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 88.73% | 97.03% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 87.77% | 91.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.67% | 86.92% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.00% | 91.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.95% | 86.33% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.56% | 95.78% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.38% | 96.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.25% | 96.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.72% | 96.77% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.13% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.11% | 99.17% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.31% | 95.71% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.27% | 95.53% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.70% | 97.14% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.64% | 92.68% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.99% | 96.00% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 80.96% | 89.23% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.39% | 93.99% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.21% | 90.71% |
Plants that contains it
Top
Below are displayed all the plants proven (via scientific papers) to contain this compound!
To see more specific details click the taxa you are interested in.
Libocedrus bidwillii |
Salvia palaestina |
Cross-Links
Top
PubChem | 46841213 |
LOTUS | LTS0003271 |
wikiData | Q105348647 |